C21H30N2 — CID 82171517
1-N,1-N-dibenzyl-4,4-dimethylpentane-1,3-diamine (PubChem CID 82171517) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-N,1-N-dibenzyl-4,4-dimethylpentane-1,3-diamine.
| Compound Name | 1-N,1-N-dibenzyl-4,4-dimethylpentane-1,3-diamine |
|---|---|
| PubChem CID | 82171517 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-N,1-N-dibenzyl-4,4-dimethylpentane-1,3-diamine |
| SMILES | CC(C)(C)C(N)CCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2/c1-21(2,3)20(22)14-15-23(16-18-10-6-4-7-11-18)17-19-12-8-5-9-13-19/h4-13,20H,14-17,22H2,1-3H3 |
| InChIKey | SDTKQUVPYSGNDA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |