C17H21N — CID 10840212
N,N-dibenzylpropan-1-amine (PubChem CID 10840212) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is N,N-dibenzylpropan-1-amine.
| Compound Name | N,N-dibenzylpropan-1-amine |
|---|---|
| PubChem CID | 10840212 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,N-dibenzylpropan-1-amine |
| SMILES | CCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-2-13-18(14-16-9-5-3-6-10-16)15-17-11-7-4-8-12-17/h3-12H,2,13-15H2,1H3 |
| InChIKey | UUCKZASIGJZKDT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |