C18H32N2 — CID 141125975
N-benzyl-N-methyl-N',N'-dipropylbutane-1,4-diamine (PubChem CID 141125975) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N-benzyl-N-methyl-N',N'-dipropylbutane-1,4-diamine.
| Compound Name | N-benzyl-N-methyl-N',N'-dipropylbutane-1,4-diamine |
|---|---|
| PubChem CID | 141125975 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N-benzyl-N-methyl-N',N'-dipropylbutane-1,4-diamine |
| SMILES | CCCN(CCC)CCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H32N2/c1-4-13-20(14-5-2)16-10-9-15-19(3)17-18-11-7-6-8-12-18/h6-8,11-12H,4-5,9-10,13-17H2,1-3H3 |
| InChIKey | NFECBPYXUJNVCR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|