C23H34ClN — CID 173190892
N,N-dibenzylnonan-1-amine;hydrochloride (PubChem CID 173190892) has the molecular formula C23H34ClN and a molecular weight of 359.98 g/mol. Its IUPAC name is N,N-dibenzylnonan-1-amine;hydrochloride.
| Compound Name | N,N-dibenzylnonan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173190892 |
| Molecular Formula | C23H34ClN |
| Molecular Weight | 359.98 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N,N-dibenzylnonan-1-amine;hydrochloride |
| SMILES | CCCCCCCCCN(Cc1ccccc1)Cc1ccccc1.Cl |
| InChI | InChI=1S/C23H33N.ClH/c1-2-3-4-5-6-7-14-19-24(20-22-15-10-8-11-16-22)21-23-17-12-9-13-18-23;/h8-13,15-18H,2-7,14,19-21H2,1H3;1H |
| InChIKey | UJBMMRCMQDEUEB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.98 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|