About N,N-dibenzyl-1-phenylmethanamine;hexane
N,N-dibenzyl-1-phenylmethanamine;hexane (PubChem CID 174855522) has the molecular formula C27H35N
and a molecular weight of 373.58 g/mol. Its IUPAC name is N,N-dibenzyl-1-phenylmethanamine;hexane.
Molecular Properties
| Compound Name | N,N-dibenzyl-1-phenylmethanamine;hexane |
| PubChem CID | 174855522 |
| Molecular Formula | C27H35N |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | N,N-dibenzyl-1-phenylmethanamine;hexane |
| SMILES | CCCCCC.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N.C6H14/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-3-5-6-4-2/h1-15H,16-18H2;3-6H2,1-2H3 |
| InChIKey | YCBNBFKIILGDGD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-1-phenylmethanamine;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-1-phenylmethanamine;hexane?
The IUPAC name of N,N-dibenzyl-1-phenylmethanamine;hexane (CID 174855522) is N,N-dibenzyl-1-phenylmethanamine;hexane.
What is the SMILES notation for N,N-dibenzyl-1-phenylmethanamine;hexane?
The canonical SMILES for N,N-dibenzyl-1-phenylmethanamine;hexane is CCCCCC.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of N,N-dibenzyl-1-phenylmethanamine;hexane?
The InChIKey is YCBNBFKIILGDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N.C6H14/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-3-5-6-4-2/h1-15H,16-18H2;3-6H2,1-2H3.
What are the key properties of N,N-dibenzyl-1-phenylmethanamine;hexane?
N,N-dibenzyl-1-phenylmethanamine;hexane has a molecular weight of 373.58 g/mol, XLogP of 7.48, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-1-phenylmethanamine;hexane is sourced from PubChem (CID 174855522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).