About N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine
N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine (PubChem CID 70589352) has the molecular formula C27H36N2
and a molecular weight of 388.60 g/mol. Its IUPAC name is N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine.
Molecular Properties
| Compound Name | N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine |
| PubChem CID | 70589352 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine |
| SMILES | CCCCCCN.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N.C6H15N/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-2-3-4-5-6-7/h1-15H,16-18H2;2-7H2,1H3 |
| InChIKey | GJIZFPOAYLCRFY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine?
The IUPAC name of N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine (CID 70589352) is N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine.
What is the SMILES notation for N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine?
The canonical SMILES for N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine is CCCCCCN.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine?
The InChIKey is GJIZFPOAYLCRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N.C6H15N/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-2-3-4-5-6-7/h1-15H,16-18H2;2-7H2,1H3.
What are the key properties of N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine?
N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine has a molecular weight of 388.60 g/mol, XLogP of 6.41, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-1-phenylmethanamine;hexan-1-amine is sourced from PubChem (CID 70589352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).