C18H24N2 — CID 90274197
N'-benzyl-N-phenyl-N'-propylethane-1,2-diamine (PubChem CID 90274197) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N'-benzyl-N-phenyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-benzyl-N-phenyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 90274197 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N'-benzyl-N-phenyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCNc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2/c1-2-14-20(16-17-9-5-3-6-10-17)15-13-19-18-11-7-4-8-12-18/h3-12,19H,2,13-16H2,1H3 |
| InChIKey | UXGKVXNHVKCLJQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |