C17H31N3 — CID 102994521
N'-(2-anilinoethyl)-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102994521) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N'-(2-anilinoethyl)-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-(2-anilinoethyl)-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102994521 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N'-(2-anilinoethyl)-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CCNc1ccccc1 |
| InChI | InChI=1S/C17H31N3/c1-4-19(5-2)14-10-15-20(6-3)16-13-18-17-11-8-7-9-12-17/h7-9,11-12,18H,4-6,10,13-16H2,1-3H3 |
| InChIKey | BMFNAEVIDBTPLH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |