C16H26N2 — CID 107402188
N'-(cyclobutylmethyl)-N'-ethyl-N-phenylpropane-1,3-diamine (PubChem CID 107402188) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-(cyclobutylmethyl)-N'-ethyl-N-phenylpropane-1,3-diamine.
| Compound Name | N'-(cyclobutylmethyl)-N'-ethyl-N-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107402188 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-(cyclobutylmethyl)-N'-ethyl-N-phenylpropane-1,3-diamine |
| SMILES | CCN(CCCNc1ccccc1)CC1CCC1 |
| InChI | InChI=1S/C16H26N2/c1-2-18(14-15-8-6-9-15)13-7-12-17-16-10-4-3-5-11-16/h3-5,10-11,15,17H,2,6-9,12-14H2,1H3 |
| InChIKey | IDLUTUTVXRSXTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|