C18H32Cl2N2 — CID 3069993
N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 3069993) has the molecular formula C18H32Cl2N2 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 3069993 |
| Molecular Formula | C18H32Cl2N2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNc1ccc(C2CCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H30N2.2ClH/c1-3-20(4-2)15-7-14-19-18-12-10-17(11-13-18)16-8-5-6-9-16;;/h10-13,16,19H,3-9,14-15H2,1-2H3;2*1H |
| InChIKey | INJIJNCFJPFMIY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|