About N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride
N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 3069993) has the molecular formula C18H32Cl2N2
and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| PubChem CID | 3069993 |
| Molecular Formula | C18H32Cl2N2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNc1ccc(C2CCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H30N2.2ClH/c1-3-20(4-2)15-7-14-19-18-12-10-17(11-13-18)16-8-5-6-9-16;;/h10-13,16,19H,3-9,14-15H2,1-2H3;2*1H |
| InChIKey | INJIJNCFJPFMIY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride?
The IUPAC name of N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride (CID 3069993) is N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
What is the SMILES notation for N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride?
The canonical SMILES for N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride is CCN(CC)CCCNc1ccc(C2CCCC2)cc1.Cl.Cl.
What is the InChIKey of N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride?
The InChIKey is INJIJNCFJPFMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2.2ClH/c1-3-20(4-2)15-7-14-19-18-12-10-17(11-13-18)16-8-5-6-9-16;;/h10-13,16,19H,3-9,14-15H2,1-2H3;2*1H.
What are the key properties of N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride?
N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride has a molecular weight of 347.37 g/mol, XLogP of 5.33, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclopentylphenyl)-N',N'-diethylpropane-1,3-diamine;dihydrochloride is sourced from PubChem (CID 3069993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).