About N'-(4-cyclohexylphenyl)ethane-1,2-diamine
N'-(4-cyclohexylphenyl)ethane-1,2-diamine (PubChem CID 82493726) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-(4-cyclohexylphenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-cyclohexylphenyl)ethane-1,2-diamine |
| PubChem CID | 82493726 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-(4-cyclohexylphenyl)ethane-1,2-diamine |
| SMILES | NCCNc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H22N2/c15-10-11-16-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-9,12,16H,1-5,10-11,15H2 |
| InChIKey | WQWYBEATJLWLEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(4-cyclohexylphenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-cyclohexylphenyl)ethane-1,2-diamine?
The IUPAC name of N'-(4-cyclohexylphenyl)ethane-1,2-diamine (CID 82493726) is N'-(4-cyclohexylphenyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(4-cyclohexylphenyl)ethane-1,2-diamine?
The canonical SMILES for N'-(4-cyclohexylphenyl)ethane-1,2-diamine is NCCNc1ccc(C2CCCCC2)cc1.
What is the InChIKey of N'-(4-cyclohexylphenyl)ethane-1,2-diamine?
The InChIKey is WQWYBEATJLWLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c15-10-11-16-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-9,12,16H,1-5,10-11,15H2.
What are the key properties of N'-(4-cyclohexylphenyl)ethane-1,2-diamine?
N'-(4-cyclohexylphenyl)ethane-1,2-diamine has a molecular weight of 218.34 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-cyclohexylphenyl)ethane-1,2-diamine is sourced from PubChem (CID 82493726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).