C10H16N4 — CID 117212308
N'-(2-cyclobutylpyrimidin-5-yl)ethane-1,2-diamine (PubChem CID 117212308) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N'-(2-cyclobutylpyrimidin-5-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-cyclobutylpyrimidin-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 117212308 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N'-(2-cyclobutylpyrimidin-5-yl)ethane-1,2-diamine |
| SMILES | NCCNc1cnc(C2CCC2)nc1 |
| InChI | InChI=1S/C10H16N4/c11-4-5-12-9-6-13-10(14-7-9)8-2-1-3-8/h6-8,12H,1-5,11H2 |
| InChIKey | XNAUWVRRMBKQFF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |