C23H35N — CID 155097457
N-(2-cycloundecylethyl)cyclodecapentaenamine (PubChem CID 155097457) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is N-(2-cycloundecylethyl)cyclodecapentaenamine.
| Compound Name | N-(2-cycloundecylethyl)cyclodecapentaenamine |
|---|---|
| PubChem CID | 155097457 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | N-(2-cycloundecylethyl)cyclodecapentaenamine |
| SMILES | c1ccccc(NCCC2CCCCCCCCCC2)cccc1 |
| InChI | InChI=1S/C23H35N/c1-2-5-9-13-17-22(16-12-8-4-1)20-21-24-23-18-14-10-6-3-7-11-15-19-23/h3,6-7,10-11,14-15,18-19,22,24H,1-2,4-5,8-9,12-13,16-17,20-21H2/b6-3-,7-3-,10-6-,11-7+,14-10+,15-11+,18-14+,19-15-,23-18+,23-19+ |
| InChIKey | FAUORVRRMZMVAY-FDHVZTGKSA-N |
| XLogP | 7.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |