C13H21N3 — CID 60919964
5-N-(2-cyclohexylethyl)pyridine-2,5-diamine (PubChem CID 60919964) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-N-(2-cyclohexylethyl)pyridine-2,5-diamine.
| Compound Name | 5-N-(2-cyclohexylethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 60919964 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-N-(2-cyclohexylethyl)pyridine-2,5-diamine |
| SMILES | Nc1ccc(NCCC2CCCCC2)cn1 |
| InChI | InChI=1S/C13H21N3/c14-13-7-6-12(10-16-13)15-9-8-11-4-2-1-3-5-11/h6-7,10-11,15H,1-5,8-9H2,(H2,14,16) |
| InChIKey | HETHCFVRJANQTP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |