C11H15N3S — CID 115488684
5-(2-cyclopropylethylamino)pyridine-2-carbothioamide (PubChem CID 115488684) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-(2-cyclopropylethylamino)pyridine-2-carbothioamide.
| Compound Name | 5-(2-cyclopropylethylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488684 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-(2-cyclopropylethylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(NCCC2CC2)cn1 |
| InChI | InChI=1S/C11H15N3S/c12-11(15)10-4-3-9(7-14-10)13-6-5-8-1-2-8/h3-4,7-8,13H,1-2,5-6H2,(H2,12,15) |
| InChIKey | CQFCOYWEPRHGKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|