C10H16N4S — CID 115488045
5-[2-(dimethylamino)ethylamino]pyridine-2-carbothioamide (PubChem CID 115488045) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylamino]pyridine-2-carbothioamide.
| Compound Name | 5-[2-(dimethylamino)ethylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488045 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-[2-(dimethylamino)ethylamino]pyridine-2-carbothioamide |
| SMILES | CN(C)CCNc1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C10H16N4S/c1-14(2)6-5-12-8-3-4-9(10(11)15)13-7-8/h3-4,7,12H,5-6H2,1-2H3,(H2,11,15) |
| InChIKey | AFVYKXVXOGFWPW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|