C10H16N4O2S2 — CID 114613962
5-[2-(dimethylamino)ethylsulfamoyl]pyridine-2-carbothioamide (PubChem CID 114613962) has the molecular formula C10H16N4O2S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylsulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[2-(dimethylamino)ethylsulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114613962 |
| Molecular Formula | C10H16N4O2S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[2-(dimethylamino)ethylsulfamoyl]pyridine-2-carbothioamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C10H16N4O2S2/c1-14(2)6-5-13-18(15,16)8-3-4-9(10(11)17)12-7-8/h3-4,7,13H,5-6H2,1-2H3,(H2,11,17) |
| InChIKey | RZRINHVTCWOYPM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|