C9H10F3N3O2S2 — CID 114614446
5-(3,3,3-trifluoropropylsulfamoyl)pyridine-2-carbothioamide (PubChem CID 114614446) has the molecular formula C9H10F3N3O2S2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-(3,3,3-trifluoropropylsulfamoyl)pyridine-2-carbothioamide.
| Compound Name | 5-(3,3,3-trifluoropropylsulfamoyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614446 |
| Molecular Formula | C9H10F3N3O2S2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-(3,3,3-trifluoropropylsulfamoyl)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H10F3N3O2S2/c10-9(11,12)3-4-15-19(16,17)6-1-2-7(8(13)18)14-5-6/h1-2,5,15H,3-4H2,(H2,13,18) |
| InChIKey | PLQCMFXHYRUWRW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|