C7H10F3N5O2S — CID 63227725
2-hydrazinyl-N-(3,3,3-trifluoropropyl)pyrimidine-5-sulfonamide (PubChem CID 63227725) has the molecular formula C7H10F3N5O2S and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-hydrazinyl-N-(3,3,3-trifluoropropyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(3,3,3-trifluoropropyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 63227725 |
| Molecular Formula | C7H10F3N5O2S |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-hydrazinyl-N-(3,3,3-trifluoropropyl)pyrimidine-5-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C7H10F3N5O2S/c8-7(9,10)1-2-14-18(16,17)5-3-12-6(15-11)13-4-5/h3-4,14H,1-2,11H2,(H,12,13,15) |
| InChIKey | MAPPHHYEKPJTNI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|