C11H12BrN5O2S — CID 61413923
N-[(2-bromophenyl)methyl]-2-hydrazinylpyrimidine-5-sulfonamide (PubChem CID 61413923) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-hydrazinylpyrimidine-5-sulfonamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2-hydrazinylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61413923 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-hydrazinylpyrimidine-5-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCc2ccccc2Br)cn1 |
| InChI | InChI=1S/C11H12BrN5O2S/c12-10-4-2-1-3-8(10)5-16-20(18,19)9-6-14-11(17-13)15-7-9/h1-4,6-7,16H,5,13H2,(H,14,15,17) |
| InChIKey | PSKXBHXPKGREMS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|