C12H13BrN4O2S — CID 61413876
N-[(2-bromophenyl)methyl]-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 61413876) has the molecular formula C12H13BrN4O2S and a molecular weight of 357.23 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-[(2-bromophenyl)methyl]-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61413876 |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NCc2ccccc2Br)cn1 |
| InChI | InChI=1S/C12H13BrN4O2S/c13-11-4-2-1-3-9(11)7-16-20(18,19)10-5-6-12(17-14)15-8-10/h1-6,8,16H,7,14H2,(H,15,17) |
| InChIKey | RETCXVGWKIMARN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|