C11H22N6O2S — CID 61329687
N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-hydrazinylpyrimidine-5-sulfonamide (PubChem CID 61329687) has the molecular formula C11H22N6O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-hydrazinylpyrimidine-5-sulfonamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-hydrazinylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61329687 |
| Molecular Formula | C11H22N6O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-hydrazinylpyrimidine-5-sulfonamide |
| SMILES | CN(C)CC(C)(C)CNS(=O)(=O)c1cnc(NN)nc1 |
| InChI | InChI=1S/C11H22N6O2S/c1-11(2,8-17(3)4)7-15-20(18,19)9-5-13-10(16-12)14-6-9/h5-6,15H,7-8,12H2,1-4H3,(H,13,14,16) |
| InChIKey | OZRYWSSITAEHPV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|