C10H12F3N3O2S2 — CID 114614340
5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614340) has the molecular formula C10H12F3N3O2S2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614340 |
| Molecular Formula | C10H12F3N3O2S2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 5-[ethyl(2,2,2-trifluoroethyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C10H12F3N3O2S2/c1-2-16(6-10(11,12)13)20(17,18)7-3-4-8(9(14)19)15-5-7/h3-5H,2,6H2,1H3,(H2,14,19) |
| InChIKey | MHDCVARUOMBBSH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|