C11H14N6O2S2 — CID 114614521
5-[methyl-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614521) has the molecular formula C11H14N6O2S2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 5-[methyl-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[methyl-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614521 |
| Molecular Formula | C11H14N6O2S2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-[methyl-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]sulfamoyl]pyridine-2-carbothioamide |
| SMILES | Cc1nc(CN(C)S(=O)(=O)c2ccc(C(N)=S)nc2)n[nH]1 |
| InChI | InChI=1S/C11H14N6O2S2/c1-7-14-10(16-15-7)6-17(2)21(18,19)8-3-4-9(11(12)20)13-5-8/h3-5H,6H2,1-2H3,(H2,12,20)(H,14,15,16) |
| InChIKey | WWXQGLCNNJLBLF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|