C13H19N3O2S2 — CID 114614470
5-[cyclopentylmethyl(methyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614470) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 5-[cyclopentylmethyl(methyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[cyclopentylmethyl(methyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614470 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-[cyclopentylmethyl(methyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CN(CC1CCCC1)S(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-16(9-10-4-2-3-5-10)20(17,18)11-6-7-12(13(14)19)15-8-11/h6-8,10H,2-5,9H2,1H3,(H2,14,19) |
| InChIKey | SACRBUBWFBEJLZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|