C11H13N5O2S2 — CID 114614500
5-[methyl(1H-pyrazol-4-ylmethyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614500) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 5-[methyl(1H-pyrazol-4-ylmethyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[methyl(1H-pyrazol-4-ylmethyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614500 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 5-[methyl(1H-pyrazol-4-ylmethyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CN(Cc1cn[nH]c1)S(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C11H13N5O2S2/c1-16(7-8-4-14-15-5-8)20(17,18)9-2-3-10(11(12)19)13-6-9/h2-6H,7H2,1H3,(H2,12,19)(H,14,15) |
| InChIKey | GHIZPPXQKNNMSQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|