C12H19N3O2S2 — CID 114614117
5-[propan-2-yl(propyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614117) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 5-[propan-2-yl(propyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[propan-2-yl(propyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614117 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-[propan-2-yl(propyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CCCN(C(C)C)S(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-4-7-15(9(2)3)19(16,17)10-5-6-11(12(13)18)14-8-10/h5-6,8-9H,4,7H2,1-3H3,(H2,13,18) |
| InChIKey | YJEPBYSDZMPKSA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|