C13H19FN2O2S2 — CID 63288509
2-fluoro-5-[propan-2-yl(propyl)sulfamoyl]benzenecarbothioamide (PubChem CID 63288509) has the molecular formula C13H19FN2O2S2 and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-fluoro-5-[propan-2-yl(propyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[propan-2-yl(propyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63288509 |
| Molecular Formula | C13H19FN2O2S2 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-fluoro-5-[propan-2-yl(propyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CCCN(C(C)C)S(=O)(=O)c1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C13H19FN2O2S2/c1-4-7-16(9(2)3)20(17,18)10-5-6-12(14)11(8-10)13(15)19/h5-6,8-9H,4,7H2,1-3H3,(H2,15,19) |
| InChIKey | DKDJTJSZIUEUSQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|