C11H15FN2O3S2 — CID 104551999
2-fluoro-5-[1-hydroxypropan-2-yl(methyl)sulfamoyl]benzenecarbothioamide (PubChem CID 104551999) has the molecular formula C11H15FN2O3S2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-fluoro-5-[1-hydroxypropan-2-yl(methyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[1-hydroxypropan-2-yl(methyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 104551999 |
| Molecular Formula | C11H15FN2O3S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-fluoro-5-[1-hydroxypropan-2-yl(methyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CC(CO)N(C)S(=O)(=O)c1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C11H15FN2O3S2/c1-7(6-15)14(2)19(16,17)8-3-4-10(12)9(5-8)11(13)18/h3-5,7,15H,6H2,1-2H3,(H2,13,18) |
| InChIKey | JKWBWVYJLOUMMZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|