C14H21FN2O2S2 — CID 63289055
5-[3,3-dimethylbutan-2-yl(methyl)sulfamoyl]-2-fluorobenzenecarbothioamide (PubChem CID 63289055) has the molecular formula C14H21FN2O2S2 and a molecular weight of 332.47 g/mol. Its IUPAC name is 5-[3,3-dimethylbutan-2-yl(methyl)sulfamoyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[3,3-dimethylbutan-2-yl(methyl)sulfamoyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63289055 |
| Molecular Formula | C14H21FN2O2S2 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 5-[3,3-dimethylbutan-2-yl(methyl)sulfamoyl]-2-fluorobenzenecarbothioamide |
| SMILES | CC(N(C)S(=O)(=O)c1ccc(F)c(C(N)=S)c1)C(C)(C)C |
| InChI | InChI=1S/C14H21FN2O2S2/c1-9(14(2,3)4)17(5)21(18,19)10-6-7-12(15)11(8-10)13(16)20/h6-9H,1-5H3,(H2,16,20) |
| InChIKey | COVYOYDQSBBCOO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|