C14H17FN2O2S2 — CID 64521555
5-[cyclopropyl(cyclopropylmethyl)sulfamoyl]-2-fluorobenzenecarbothioamide (PubChem CID 64521555) has the molecular formula C14H17FN2O2S2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 5-[cyclopropyl(cyclopropylmethyl)sulfamoyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[cyclopropyl(cyclopropylmethyl)sulfamoyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 64521555 |
| Molecular Formula | C14H17FN2O2S2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-[cyclopropyl(cyclopropylmethyl)sulfamoyl]-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(S(=O)(=O)N(CC2CC2)C2CC2)ccc1F |
| InChI | InChI=1S/C14H17FN2O2S2/c15-13-6-5-11(7-12(13)14(16)20)21(18,19)17(10-3-4-10)8-9-1-2-9/h5-7,9-10H,1-4,8H2,(H2,16,20) |
| InChIKey | GLIPNYJVIQVRHO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|