C13H21FN2O2S — CID 28716397
5-(aminomethyl)-2-fluoro-N,N-dipropylbenzenesulfonamide (PubChem CID 28716397) has the molecular formula C13H21FN2O2S and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-(aminomethyl)-2-fluoro-N,N-dipropylbenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2-fluoro-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 28716397 |
| Molecular Formula | C13H21FN2O2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-(aminomethyl)-2-fluoro-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cc(CN)ccc1F |
| InChI | InChI=1S/C13H21FN2O2S/c1-3-7-16(8-4-2)19(17,18)13-9-11(10-15)5-6-12(13)14/h5-6,9H,3-4,7-8,10,15H2,1-2H3 |
| InChIKey | YSMOWOORMKDYDE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |