C13H17F2NO4S — CID 61008684
ethyl 2-[(2,5-difluorophenyl)sulfonyl-propylamino]acetate (PubChem CID 61008684) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is ethyl 2-[(2,5-difluorophenyl)sulfonyl-propylamino]acetate.
| Compound Name | ethyl 2-[(2,5-difluorophenyl)sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 61008684 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 2-[(2,5-difluorophenyl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2NO4S/c1-3-7-16(9-13(17)20-4-2)21(18,19)12-8-10(14)5-6-11(12)15/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | GECSTDNMDHHNIL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |