C18H27F2N3O4S — CID 18289830
N-butyl-2-[[2-(butylamino)-2-oxoethyl]-(2,5-difluorophenyl)sulfonylamino]acetamide (PubChem CID 18289830) has the molecular formula C18H27F2N3O4S and a molecular weight of 419.49 g/mol. Its IUPAC name is N-butyl-2-[[2-(butylamino)-2-oxoethyl]-(2,5-difluorophenyl)sulfonylamino]acetamide.
| Compound Name | N-butyl-2-[[2-(butylamino)-2-oxoethyl]-(2,5-difluorophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 18289830 |
| Molecular Formula | C18H27F2N3O4S |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-butyl-2-[[2-(butylamino)-2-oxoethyl]-(2,5-difluorophenyl)sulfonylamino]acetamide |
| SMILES | CCCCNC(=O)CN(CC(=O)NCCCC)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H27F2N3O4S/c1-3-5-9-21-17(24)12-23(13-18(25)22-10-6-4-2)28(26,27)16-11-14(19)7-8-15(16)20/h7-8,11H,3-6,9-10,12-13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | VTNYLVDDRSSYLU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|