C16H23F2N3O3S — CID 26630104
N-butyl-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 26630104) has the molecular formula C16H23F2N3O3S and a molecular weight of 375.44 g/mol. Its IUPAC name is N-butyl-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 26630104 |
| Molecular Formula | C16H23F2N3O3S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-butyl-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H23F2N3O3S/c1-2-3-6-19-16(22)12-20-7-9-21(10-8-20)25(23,24)15-11-13(17)4-5-14(15)18/h4-5,11H,2-3,6-10,12H2,1H3,(H,19,22) |
| InChIKey | TVHWCKLPHMNBTM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|