C15H20F2N2O4S — CID 52788016
ethyl 2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetate (PubChem CID 52788016) has the molecular formula C15H20F2N2O4S and a molecular weight of 362.40 g/mol. Its IUPAC name is ethyl 2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetate.
| Compound Name | ethyl 2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 52788016 |
| Molecular Formula | C15H20F2N2O4S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | ethyl 2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O4S/c1-2-23-15(20)11-18-6-3-7-19(9-8-18)24(21,22)14-10-12(16)4-5-13(14)17/h4-5,10H,2-3,6-9,11H2,1H3 |
| InChIKey | XSTGBQPKIUAWKE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |