C12H16F2N2O3S — CID 43392116
2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]ethanol (PubChem CID 43392116) has the molecular formula C12H16F2N2O3S and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]ethanol.
| Compound Name | 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 43392116 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]ethanol |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C12H16F2N2O3S/c13-10-1-2-11(14)12(9-10)20(18,19)16-5-3-15(4-6-16)7-8-17/h1-2,9,17H,3-8H2 |
| InChIKey | CYFLBKSQIVIBNI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |