C13H18F2N2O3S — CID 84591436
2-[4-(2,5-difluoro-4-methylphenyl)sulfonylpiperazin-1-yl]ethanol (PubChem CID 84591436) has the molecular formula C13H18F2N2O3S and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[4-(2,5-difluoro-4-methylphenyl)sulfonylpiperazin-1-yl]ethanol.
| Compound Name | 2-[4-(2,5-difluoro-4-methylphenyl)sulfonylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 84591436 |
| Molecular Formula | C13H18F2N2O3S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[4-(2,5-difluoro-4-methylphenyl)sulfonylpiperazin-1-yl]ethanol |
| SMILES | Cc1cc(F)c(S(=O)(=O)N2CCN(CCO)CC2)cc1F |
| InChI | InChI=1S/C13H18F2N2O3S/c1-10-8-12(15)13(9-11(10)14)21(19,20)17-4-2-16(3-5-17)6-7-18/h8-9,18H,2-7H2,1H3 |
| InChIKey | WTEIGQDSVVYDAL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |