C17H28N2O3S — CID 2495559
2-[4-(5-tert-butyl-2-methylphenyl)sulfonylpiperazin-1-yl]ethanol (PubChem CID 2495559) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-[4-(5-tert-butyl-2-methylphenyl)sulfonylpiperazin-1-yl]ethanol.
| Compound Name | 2-[4-(5-tert-butyl-2-methylphenyl)sulfonylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 2495559 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[4-(5-tert-butyl-2-methylphenyl)sulfonylpiperazin-1-yl]ethanol |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C17H28N2O3S/c1-14-5-6-15(17(2,3)4)13-16(14)23(21,22)19-9-7-18(8-10-19)11-12-20/h5-6,13,20H,7-12H2,1-4H3 |
| InChIKey | WHIXIDVZNKNYOF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |