C21H35N3O2S — CID 86959903
1-(5-tert-butyl-2-methylphenyl)sulfonyl-4-(1-methylpiperidin-3-yl)piperazine (PubChem CID 86959903) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methylphenyl)sulfonyl-4-(1-methylpiperidin-3-yl)piperazine.
| Compound Name | 1-(5-tert-butyl-2-methylphenyl)sulfonyl-4-(1-methylpiperidin-3-yl)piperazine |
|---|---|
| PubChem CID | 86959903 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-(5-tert-butyl-2-methylphenyl)sulfonyl-4-(1-methylpiperidin-3-yl)piperazine |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCN(C2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C21H35N3O2S/c1-17-8-9-18(21(2,3)4)15-20(17)27(25,26)24-13-11-23(12-14-24)19-7-6-10-22(5)16-19/h8-9,15,19H,6-7,10-14,16H2,1-5H3 |
| InChIKey | BYALAFSFIRMNKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |