C17H25N3O4S — CID 90146968
1-cyclohexyl-4-(2-methyl-5-nitrophenyl)sulfonylpiperazine (PubChem CID 90146968) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2-methyl-5-nitrophenyl)sulfonylpiperazine.
| Compound Name | 1-cyclohexyl-4-(2-methyl-5-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 90146968 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-cyclohexyl-4-(2-methyl-5-nitrophenyl)sulfonylpiperazine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-14-7-8-16(20(21)22)13-17(14)25(23,24)19-11-9-18(10-12-19)15-5-3-2-4-6-15/h7-8,13,15H,2-6,9-12H2,1H3 |
| InChIKey | LNBGIGBIQDMUQC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|