C18H26N4O7S2 — CID 24517813
[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 24517813) has the molecular formula C18H26N4O7S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 24517813 |
| Molecular Formula | C18H26N4O7S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)N2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C18H26N4O7S2/c1-14-3-4-16(22(24)25)13-17(14)31(28,29)21-7-5-15(6-8-21)18(23)19-9-11-20(12-10-19)30(2,26)27/h3-4,13,15H,5-12H2,1-2H3 |
| InChIKey | YYMKDSFPXRBVEE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|