C13H18N2O6S2 — CID 90585251
1-(2-methyl-5-nitrophenyl)sulfonyl-4-methylsulfonylpiperidine (PubChem CID 90585251) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-(2-methyl-5-nitrophenyl)sulfonyl-4-methylsulfonylpiperidine.
| Compound Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-4-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 90585251 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-4-methylsulfonylpiperidine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H18N2O6S2/c1-10-3-4-11(15(16)17)9-13(10)23(20,21)14-7-5-12(6-8-14)22(2,18)19/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | HIDXBLALPVSNAQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|