C19H22N2O4S2 — CID 90631470
4-(2-methyl-5-nitrophenyl)sulfonyl-7-(2-methylphenyl)-1,4-thiazepane (PubChem CID 90631470) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(2-methyl-5-nitrophenyl)sulfonyl-7-(2-methylphenyl)-1,4-thiazepane.
| Compound Name | 4-(2-methyl-5-nitrophenyl)sulfonyl-7-(2-methylphenyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90631470 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-(2-methyl-5-nitrophenyl)sulfonyl-7-(2-methylphenyl)-1,4-thiazepane |
| SMILES | Cc1ccccc1C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2C)CCS1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-14-5-3-4-6-17(14)18-9-10-20(11-12-26-18)27(24,25)19-13-16(21(22)23)8-7-15(19)2/h3-8,13,18H,9-12H2,1-2H3 |
| InChIKey | YNFSLAOEUQKFNO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|