C24H25NO2S2 — CID 121163765
7-(2-methylphenyl)-4-(4-phenylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 121163765) has the molecular formula C24H25NO2S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 7-(2-methylphenyl)-4-(4-phenylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(2-methylphenyl)-4-(4-phenylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 121163765 |
| Molecular Formula | C24H25NO2S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 7-(2-methylphenyl)-4-(4-phenylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | Cc1ccccc1C1CCN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)CCS1 |
| InChI | InChI=1S/C24H25NO2S2/c1-19-7-5-6-10-23(19)24-15-16-25(17-18-28-24)29(26,27)22-13-11-21(12-14-22)20-8-3-2-4-9-20/h2-14,24H,15-18H2,1H3 |
| InChIKey | FHTLQAJTAHFVAZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |