C20H24ClNO2S2 — CID 121163612
7-(2-chlorophenyl)-4-(4-propylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 121163612) has the molecular formula C20H24ClNO2S2 and a molecular weight of 410.00 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-(4-propylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(2-chlorophenyl)-4-(4-propylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 121163612 |
| Molecular Formula | C20H24ClNO2S2 |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 7-(2-chlorophenyl)-4-(4-propylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCSC(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H24ClNO2S2/c1-2-5-16-8-10-17(11-9-16)26(23,24)22-13-12-20(25-15-14-22)18-6-3-4-7-19(18)21/h3-4,6-11,20H,2,5,12-15H2,1H3 |
| InChIKey | YCNJJPIQOASUQB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |