C19H22ClNO2S2 — CID 90629925
7-(2-chlorophenyl)-4-(2,5-dimethylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 90629925) has the molecular formula C19H22ClNO2S2 and a molecular weight of 395.98 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-4-(2,5-dimethylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 7-(2-chlorophenyl)-4-(2,5-dimethylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90629925 |
| Molecular Formula | C19H22ClNO2S2 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 7-(2-chlorophenyl)-4-(2,5-dimethylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCSC(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H22ClNO2S2/c1-14-7-8-15(2)19(13-14)25(22,23)21-10-9-18(24-12-11-21)16-5-3-4-6-17(16)20/h3-8,13,18H,9-12H2,1-2H3 |
| InChIKey | DSLLNTCQHYIDQM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |