C18H21ClN2O4S2 — CID 26945221
1-(2-chlorophenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine (PubChem CID 26945221) has the molecular formula C18H21ClN2O4S2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26945221 |
| Molecular Formula | C18H21ClN2O4S2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H21ClN2O4S2/c1-14-7-8-15(2)18(13-14)27(24,25)21-11-9-20(10-12-21)26(22,23)17-6-4-3-5-16(17)19/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | GLMMUDAOYWKJSP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |