C18H19ClN2O4S — CID 27799663
[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(2-hydroxy-5-methylphenyl)methanone (PubChem CID 27799663) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(2-hydroxy-5-methylphenyl)methanone.
| Compound Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 27799663 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(2-hydroxy-5-methylphenyl)methanone |
| SMILES | Cc1ccc(O)c(C(=O)N2CCN(S(=O)(=O)c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-13-6-7-16(22)14(12-13)18(23)20-8-10-21(11-9-20)26(24,25)17-5-3-2-4-15(17)19/h2-7,12,22H,8-11H2,1H3 |
| InChIKey | QZVIKTFGYOHOEH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |