C19H23ClN2O4S2 — CID 26945213
1-(2-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine (PubChem CID 26945213) has the molecular formula C19H23ClN2O4S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26945213 |
| Molecular Formula | C19H23ClN2O4S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccccc3Cl)CC2)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2O4S2/c1-14-12-15(2)19(16(3)13-14)28(25,26)22-10-8-21(9-11-22)27(23,24)18-7-5-4-6-17(18)20/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | ZGYGINIDDGGQSH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |